C7H12O2 — CID 129451617
(2R)-4,4-dimethyloxolane-2-carbaldehyde (PubChem CID 129451617) has the molecular formula C7H12O2 and a molecular weight of 128.17 g/mol. Its IUPAC name is (2R)-4,4-dimethyloxolane-2-carbaldehyde.
| Compound Name | (2R)-4,4-dimethyloxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 129451617 |
| Molecular Formula | C7H12O2 |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.08 |
| IUPAC Name | (2R)-4,4-dimethyloxolane-2-carbaldehyde |
| SMILES | CC1(C)CO[C@@H](C=O)C1 |
| InChI | InChI=1S/C7H12O2/c1-7(2)3-6(4-8)9-5-7/h4,6H,3,5H2,1-2H3/t6-/m1/s1 |
| InChIKey | NDPMNCZNLGUWFC-ZCFIWIBFSA-N |
| XLogP | 1.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|