C9H10Cl2O4 — CID 151640389
5,6-dichloro-5,6-dimethoxycyclohexa-1,3-diene-1-carboxylic acid (PubChem CID 151640389) has the molecular formula C9H10Cl2O4 and a molecular weight of 253.08 g/mol. Its IUPAC name is 5,6-dichloro-5,6-dimethoxycyclohexa-1,3-diene-1-carboxylic acid.
| Compound Name | 5,6-dichloro-5,6-dimethoxycyclohexa-1,3-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 151640389 |
| Molecular Formula | C9H10Cl2O4 |
| Molecular Weight | 253.08 g/mol |
| Exact Mass | 252.00 |
| IUPAC Name | 5,6-dichloro-5,6-dimethoxycyclohexa-1,3-diene-1-carboxylic acid |
| SMILES | COC1(Cl)C=CC=C(C(=O)O)C1(Cl)OC |
| InChI | InChI=1S/C9H10Cl2O4/c1-14-8(10)5-3-4-6(7(12)13)9(8,11)15-2/h3-5H,1-2H3,(H,12,13) |
| InChIKey | QSJZLTMJRYUUSH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.08 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|