C7H6ClFO2 — CID 141483693
1-chloro-5-fluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 141483693) has the molecular formula C7H6ClFO2 and a molecular weight of 176.57 g/mol. Its IUPAC name is 1-chloro-5-fluorocyclohexa-2,4-diene-1-carboxylic acid.
| Compound Name | 1-chloro-5-fluorocyclohexa-2,4-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 141483693 |
| Molecular Formula | C7H6ClFO2 |
| Molecular Weight | 176.57 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 1-chloro-5-fluorocyclohexa-2,4-diene-1-carboxylic acid |
| SMILES | O=C(O)C1(Cl)C=CC=C(F)C1 |
| InChI | InChI=1S/C7H6ClFO2/c8-7(6(10)11)3-1-2-5(9)4-7/h1-3H,4H2,(H,10,11) |
| InChIKey | LDXNEGTUQDCNCI-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.57 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|