6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid

C7H6ClFO2 — CID 90024816

IUPAC6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC=CC1(F)Cl
InChIInChI=1S/C7H6ClFO2/c8-7(9)4-2-1-3-5(7)6(10)11/h1-5H,(H,10,11)
InChIKeyHUPAQHGDMHSGFS-UHFFFAOYSA-N
MW176.57 g/mol
LogP1.72
Rot. Bonds1

About 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid

6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid (PubChem CID 90024816) has the molecular formula C7H6ClFO2 and a molecular weight of 176.57 g/mol. Its IUPAC name is 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid.

Molecular Properties

Compound Name6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid
PubChem CID90024816
Molecular FormulaC7H6ClFO2
Molecular Weight176.57 g/mol
Exact Mass176.00
IUPAC Name6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid
SMILESO=C(O)C1C=CC=CC1(F)Cl
InChIInChI=1S/C7H6ClFO2/c8-7(9)4-2-1-3-5(7)6(10)11/h1-5H,(H,10,11)
InChIKeyHUPAQHGDMHSGFS-UHFFFAOYSA-N
XLogP1.72
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.57
LogP ≤ 51.72
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The IUPAC name of 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid (CID 90024816) is 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid.
What is the SMILES notation for 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The canonical SMILES for 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid is O=C(O)C1C=CC=CC1(F)Cl.
What is the InChIKey of 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
The InChIKey is HUPAQHGDMHSGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClFO2/c8-7(9)4-2-1-3-5(7)6(10)11/h1-5H,(H,10,11).
What are the key properties of 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid?
6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid has a molecular weight of 176.57 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-6-fluorocyclohexa-2,4-diene-1-carboxylic acid is sourced from PubChem (CID 90024816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).