C9H11NO — CID 160906058
1,2,4a,8a-tetrahydroquinolin-8-ol (PubChem CID 160906058) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 1,2,4a,8a-tetrahydroquinolin-8-ol.
| Compound Name | 1,2,4a,8a-tetrahydroquinolin-8-ol |
|---|---|
| PubChem CID | 160906058 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 1,2,4a,8a-tetrahydroquinolin-8-ol |
| SMILES | OC1=CC=CC2C=CCNC12 |
| InChI | InChI=1S/C9H11NO/c11-8-5-1-3-7-4-2-6-10-9(7)8/h1-5,7,9-11H,6H2 |
| InChIKey | SBYKBOXWMDEHEN-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|