About 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine
2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine (PubChem CID 67356775) has the molecular formula C8H13N3
and a molecular weight of 151.21 g/mol. Its IUPAC name is 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine.
Analyze 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine?
The IUPAC name of 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine (CID 67356775) is 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine.
What is the SMILES notation for 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine?
The canonical SMILES for 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine is C1=CCNC2CNCNC2=C1.
What is the InChIKey of 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine?
The InChIKey is AOOIOLKYRZTRDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3/c1-2-4-10-8-5-9-6-11-7(8)3-1/h1-3,8-11H,4-6H2.
What are the key properties of 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine?
2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine has a molecular weight of 151.21 g/mol, XLogP of -0.45, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,4,4a,5,6-hexahydro-1H-pyrimido[5,4-b]azepine is sourced from PubChem (CID 67356775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).