C6H10N2 — CID 11094563
(6aR)-1,2,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole (PubChem CID 11094563) has the molecular formula C6H10N2 and a molecular weight of 110.16 g/mol. Its IUPAC name is (6aR)-1,2,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole.
| Compound Name | (6aR)-1,2,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole |
|---|---|
| PubChem CID | 11094563 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | (6aR)-1,2,4,5,6,6a-hexahydropyrrolo[3,4-b]pyrrole |
| SMILES | C1=C2CNC[C@@H]2NC1 |
| InChI | InChI=1S/C6H10N2/c1-2-8-6-4-7-3-5(1)6/h1,6-8H,2-4H2/t6-/m0/s1 |
| InChIKey | DBBCPJBZSLOISJ-LURJTMIESA-N |
| XLogP | -0.51 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|