C7H12N2O — CID 172726440
3,4,4a,5,6,7-hexahydro-2H-pyrido[4,3-b][1,4]oxazine (PubChem CID 172726440) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is 3,4,4a,5,6,7-hexahydro-2H-pyrido[4,3-b][1,4]oxazine.
| Compound Name | 3,4,4a,5,6,7-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
|---|---|
| PubChem CID | 172726440 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 3,4,4a,5,6,7-hexahydro-2H-pyrido[4,3-b][1,4]oxazine |
| SMILES | C1=C2OCCNC2CNC1 |
| InChI | InChI=1S/C7H12N2O/c1-2-8-5-6-7(1)10-4-3-9-6/h1,6,8-9H,2-5H2 |
| InChIKey | HFDMCZRNWNYCIT-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |