C7H10N2OS — CID 82598222
3-(1,3-thiazol-5-yl)morpholine (PubChem CID 82598222) has the molecular formula C7H10N2OS and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-yl)morpholine.
| Compound Name | 3-(1,3-thiazol-5-yl)morpholine |
|---|---|
| PubChem CID | 82598222 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 3-(1,3-thiazol-5-yl)morpholine |
| SMILES | c1ncc(C2COCCN2)s1 |
| InChI | InChI=1S/C7H10N2OS/c1-2-10-4-6(9-1)7-3-8-5-11-7/h3,5-6,9H,1-2,4H2 |
| InChIKey | AGKJPKXGONOKGR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |