C7H9ClN2S — CID 177219966
5-[(2R,4R)-4-chloropyrrolidin-2-yl]-1,3-thiazole (PubChem CID 177219966) has the molecular formula C7H9ClN2S and a molecular weight of 188.68 g/mol. Its IUPAC name is 5-[(2R,4R)-4-chloropyrrolidin-2-yl]-1,3-thiazole.
| Compound Name | 5-[(2R,4R)-4-chloropyrrolidin-2-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 177219966 |
| Molecular Formula | C7H9ClN2S |
| Molecular Weight | 188.68 g/mol |
| Exact Mass | 188.02 |
| IUPAC Name | 5-[(2R,4R)-4-chloropyrrolidin-2-yl]-1,3-thiazole |
| SMILES | Cl[C@H]1CN[C@@H](c2cncs2)C1 |
| InChI | InChI=1S/C7H9ClN2S/c8-5-1-6(10-2-5)7-3-9-4-11-7/h3-6,10H,1-2H2/t5-,6-/m1/s1 |
| InChIKey | OTNOWROCDHDDCV-PHDIDXHHSA-N |
| XLogP | 1.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|