C8H12N2S — CID 96632228
5-[(3R)-piperidin-3-yl]-1,3-thiazole (PubChem CID 96632228) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 5-[(3R)-piperidin-3-yl]-1,3-thiazole.
| Compound Name | 5-[(3R)-piperidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 96632228 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 5-[(3R)-piperidin-3-yl]-1,3-thiazole |
| SMILES | c1ncc([C@@H]2CCCNC2)s1 |
| InChI | InChI=1S/C8H12N2S/c1-2-7(4-9-3-1)8-5-10-6-11-8/h5-7,9H,1-4H2/t7-/m1/s1 |
| InChIKey | NREKQZQIRFJAGL-SSDOTTSWSA-N |
| XLogP | 1.61 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |