C8H11ClN2S — CID 84671186
4-chloro-5-piperidin-3-yl-1,2-thiazole (PubChem CID 84671186) has the molecular formula C8H11ClN2S and a molecular weight of 202.71 g/mol. Its IUPAC name is 4-chloro-5-piperidin-3-yl-1,2-thiazole.
| Compound Name | 4-chloro-5-piperidin-3-yl-1,2-thiazole |
|---|---|
| PubChem CID | 84671186 |
| Molecular Formula | C8H11ClN2S |
| Molecular Weight | 202.71 g/mol |
| Exact Mass | 202.03 |
| IUPAC Name | 4-chloro-5-piperidin-3-yl-1,2-thiazole |
| SMILES | Clc1cnsc1C1CCCNC1 |
| InChI | InChI=1S/C8H11ClN2S/c9-7-5-11-12-8(7)6-2-1-3-10-4-6/h5-6,10H,1-4H2 |
| InChIKey | JQTSIPMGTUWTHQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.71 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |