C8H12N2OS — CID 83684160
2-piperidin-3-yl-1,3-thiazol-4-ol (PubChem CID 83684160) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-piperidin-3-yl-1,3-thiazol-4-ol.
| Compound Name | 2-piperidin-3-yl-1,3-thiazol-4-ol |
|---|---|
| PubChem CID | 83684160 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-piperidin-3-yl-1,3-thiazol-4-ol |
| SMILES | Oc1csc(C2CCCNC2)n1 |
| InChI | InChI=1S/C8H12N2OS/c11-7-5-12-8(10-7)6-2-1-3-9-4-6/h5-6,9,11H,1-4H2 |
| InChIKey | TZZWJJSPACAOMW-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |