C14H14Cl2N2S — CID 62541775
4-(2,5-dichlorophenyl)-2-piperidin-3-yl-1,3-thiazole (PubChem CID 62541775) has the molecular formula C14H14Cl2N2S and a molecular weight of 313.25 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-2-piperidin-3-yl-1,3-thiazole.
| Compound Name | 4-(2,5-dichlorophenyl)-2-piperidin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 62541775 |
| Molecular Formula | C14H14Cl2N2S |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-2-piperidin-3-yl-1,3-thiazole |
| SMILES | Clc1ccc(Cl)c(-c2csc(C3CCCNC3)n2)c1 |
| InChI | InChI=1S/C14H14Cl2N2S/c15-10-3-4-12(16)11(6-10)13-8-19-14(18-13)9-2-1-5-17-7-9/h3-4,6,8-9,17H,1-2,5,7H2 |
| InChIKey | IUHCNFGXBHVABA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |