C6H6N2S2 — CID 146424213
5-(4,5-dihydro-1,3-thiazol-5-yl)-1,3-thiazole (PubChem CID 146424213) has the molecular formula C6H6N2S2 and a molecular weight of 170.26 g/mol. Its IUPAC name is 5-(4,5-dihydro-1,3-thiazol-5-yl)-1,3-thiazole.
| Compound Name | 5-(4,5-dihydro-1,3-thiazol-5-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 146424213 |
| Molecular Formula | C6H6N2S2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 5-(4,5-dihydro-1,3-thiazol-5-yl)-1,3-thiazole |
| SMILES | C1=NCC(c2cncs2)S1 |
| InChI | InChI=1S/C6H6N2S2/c1-5(9-3-7-1)6-2-8-4-10-6/h1,3-4,6H,2H2 |
| InChIKey | FPEIUKXVPFLJGS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |