C7H7N3OS — CID 175393841
3-(1,3-thiazol-5-yl)-3,4-dihydropyrazole-2-carbaldehyde (PubChem CID 175393841) has the molecular formula C7H7N3OS and a molecular weight of 181.22 g/mol. Its IUPAC name is 3-(1,3-thiazol-5-yl)-3,4-dihydropyrazole-2-carbaldehyde.
| Compound Name | 3-(1,3-thiazol-5-yl)-3,4-dihydropyrazole-2-carbaldehyde |
|---|---|
| PubChem CID | 175393841 |
| Molecular Formula | C7H7N3OS |
| Molecular Weight | 181.22 g/mol |
| Exact Mass | 181.03 |
| IUPAC Name | 3-(1,3-thiazol-5-yl)-3,4-dihydropyrazole-2-carbaldehyde |
| SMILES | O=CN1N=CCC1c1cncs1 |
| InChI | InChI=1S/C7H7N3OS/c11-5-10-6(1-2-9-10)7-3-8-4-12-7/h2-6H,1H2 |
| InChIKey | UTZYFKUEAHDKOH-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 45.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|