C7H9NO2 — CID 175672757
3,3a,5,6-tetrahydro-2H-furo[3,2-c]pyridin-4-one (PubChem CID 175672757) has the molecular formula C7H9NO2 and a molecular weight of 139.15 g/mol. Its IUPAC name is 3,3a,5,6-tetrahydro-2H-furo[3,2-c]pyridin-4-one.
| Compound Name | 3,3a,5,6-tetrahydro-2H-furo[3,2-c]pyridin-4-one |
|---|---|
| PubChem CID | 175672757 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 3,3a,5,6-tetrahydro-2H-furo[3,2-c]pyridin-4-one |
| SMILES | O=C1NCC=C2OCCC12 |
| InChI | InChI=1S/C7H9NO2/c9-7-5-2-4-10-6(5)1-3-8-7/h1,5H,2-4H2,(H,8,9) |
| InChIKey | WCZALRYJISIVCF-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |