C9H8O3 — CID 18932610
4,4a-dihydro-3H-isochromene-5,8-dione (PubChem CID 18932610) has the molecular formula C9H8O3 and a molecular weight of 164.16 g/mol. Its IUPAC name is 4,4a-dihydro-3H-isochromene-5,8-dione.
| Compound Name | 4,4a-dihydro-3H-isochromene-5,8-dione |
|---|---|
| PubChem CID | 18932610 |
| Molecular Formula | C9H8O3 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.05 |
| IUPAC Name | 4,4a-dihydro-3H-isochromene-5,8-dione |
| SMILES | O=C1C=CC(=O)C2CCOC=C12 |
| InChI | InChI=1S/C9H8O3/c10-8-1-2-9(11)7-5-12-4-3-6(7)8/h1-2,5-6H,3-4H2 |
| InChIKey | BVGSLBLMBYDMKO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |