C9H8O — CID 142717296
7,7a-dihydroinden-4-one (PubChem CID 142717296) has the molecular formula C9H8O and a molecular weight of 132.16 g/mol. Its IUPAC name is 7,7a-dihydroinden-4-one.
| Compound Name | 7,7a-dihydroinden-4-one |
|---|---|
| PubChem CID | 142717296 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 7,7a-dihydroinden-4-one |
| SMILES | O=C1C=CCC2C=CC=C12 |
| InChI | InChI=1S/C9H8O/c10-9-6-2-4-7-3-1-5-8(7)9/h1-3,5-7H,4H2 |
| InChIKey | GMVJZZUFNGFZDM-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |