C20H18O2 — CID 123935194
5-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-5a,8b-dihydroacenaphthylene-1,2-dione (PubChem CID 123935194) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is 5-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-5a,8b-dihydroacenaphthylene-1,2-dione.
| Compound Name | 5-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-5a,8b-dihydroacenaphthylene-1,2-dione |
|---|---|
| PubChem CID | 123935194 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-(2,6-dimethylcyclohexa-1,3-dien-1-yl)-5a,8b-dihydroacenaphthylene-1,2-dione |
| SMILES | CC1=C(C2=CC=C3C(=O)C(=O)C4=CC=CC2C43)C(C)CC=C1 |
| InChI | InChI=1S/C20H18O2/c1-11-5-3-6-12(2)17(11)14-9-10-16-18-13(14)7-4-8-15(18)19(21)20(16)22/h3-5,7-10,12-13,18H,6H2,1-2H3 |
| InChIKey | YYYRAHZCYQTFAN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|