C12H12 — CID 143575355
1,2,5,5a-tetrahydroacenaphthylene (PubChem CID 143575355) has the molecular formula C12H12 and a molecular weight of 156.23 g/mol. Its IUPAC name is 1,2,5,5a-tetrahydroacenaphthylene.
| Compound Name | 1,2,5,5a-tetrahydroacenaphthylene |
|---|---|
| PubChem CID | 143575355 |
| Molecular Formula | C12H12 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 1,2,5,5a-tetrahydroacenaphthylene |
| SMILES | C1=CC2CC=CC3=C2C(=C1)CC3 |
| InChI | InChI=1S/C12H12/c1-3-9-4-2-6-11-8-7-10(5-1)12(9)11/h1-3,5-6,9H,4,7-8H2 |
| InChIKey | VDVFEEYAPFZAJF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |