C13H16 — CID 173020633
4a,5,8,8a,9,9a-hexahydro-4H-cyclopenta[b]naphthalene (PubChem CID 173020633) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 4a,5,8,8a,9,9a-hexahydro-4H-cyclopenta[b]naphthalene.
| Compound Name | 4a,5,8,8a,9,9a-hexahydro-4H-cyclopenta[b]naphthalene |
|---|---|
| PubChem CID | 173020633 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 4a,5,8,8a,9,9a-hexahydro-4H-cyclopenta[b]naphthalene |
| SMILES | C1=CC2CC3CC=CCC3CC2=C1 |
| InChI | InChI=1S/C13H16/c1-2-5-11-9-13-7-3-6-12(13)8-10(11)4-1/h1-3,6-7,10-12H,4-5,8-9H2 |
| InChIKey | ZBBRMFTYIWPGCZ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|