C10H14 — CID 91083284
6-methyl-4,5,6,7-tetrahydro-3aH-indene (PubChem CID 91083284) has the molecular formula C10H14 and a molecular weight of 134.22 g/mol. Its IUPAC name is 6-methyl-4,5,6,7-tetrahydro-3aH-indene.
| Compound Name | 6-methyl-4,5,6,7-tetrahydro-3aH-indene |
|---|---|
| PubChem CID | 91083284 |
| Molecular Formula | C10H14 |
| Molecular Weight | 134.22 g/mol |
| Exact Mass | 134.11 |
| IUPAC Name | 6-methyl-4,5,6,7-tetrahydro-3aH-indene |
| SMILES | CC1CCC2C=CC=C2C1 |
| InChI | InChI=1S/C10H14/c1-8-5-6-9-3-2-4-10(9)7-8/h2-4,8-9H,5-7H2,1H3 |
| InChIKey | FWDSBKQTVPVGQO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |