C30H28 — CID 123230629
7,12-di(cyclohexa-1,3-dien-1-yl)-3,4,6a,12a-tetrahydrobenzo[a]anthracene (PubChem CID 123230629) has the molecular formula C30H28 and a molecular weight of 388.55 g/mol. Its IUPAC name is 7,12-di(cyclohexa-1,3-dien-1-yl)-3,4,6a,12a-tetrahydrobenzo[a]anthracene.
| Compound Name | 7,12-di(cyclohexa-1,3-dien-1-yl)-3,4,6a,12a-tetrahydrobenzo[a]anthracene |
|---|---|
| PubChem CID | 123230629 |
| Molecular Formula | C30H28 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 7,12-di(cyclohexa-1,3-dien-1-yl)-3,4,6a,12a-tetrahydrobenzo[a]anthracene |
| SMILES | C1=CCCC(C2=c3ccccc3=C(C3=CC=CCC3)C3C4=C(C=CC23)CCC=C4)=C1 |
| InChI | InChI=1S/C30H28/c1-3-12-22(13-4-1)28-25-17-9-10-18-26(25)29(23-14-5-2-6-15-23)30-24-16-8-7-11-21(24)19-20-27(28)30/h1-3,5,8-10,12,14,16-20,27,30H,4,6-7,11,13,15H2 |
| InChIKey | HFFKULKVWCWVTO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |