C38H34 — CID 123796505
9-[12-(2,3-dihydronaphthalen-1-yl)-4a,12a-dihydrobenzo[10]annulen-5-yl]-1,2,4b,8a-tetrahydrophenanthrene (PubChem CID 123796505) has the molecular formula C38H34 and a molecular weight of 490.69 g/mol. Its IUPAC name is 9-[12-(2,3-dihydronaphthalen-1-yl)-4a,12a-dihydrobenzo[10]annulen-5-yl]-1,2,4b,8a-tetrahydrophenanthrene.
| Compound Name | 9-[12-(2,3-dihydronaphthalen-1-yl)-4a,12a-dihydrobenzo[10]annulen-5-yl]-1,2,4b,8a-tetrahydrophenanthrene |
|---|---|
| PubChem CID | 123796505 |
| Molecular Formula | C38H34 |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 9-[12-(2,3-dihydronaphthalen-1-yl)-4a,12a-dihydrobenzo[10]annulen-5-yl]-1,2,4b,8a-tetrahydrophenanthrene |
| SMILES | C1=CC=C(C2=CC3=C(C=CCC3)C3C=CC=CC23)C2C=CC=CC2C(C2=c3ccccc3=CCC2)=CC=C1 |
| InChI | InChI=1S/C38H34/c1-2-4-20-37(38-26-28-15-6-8-18-30(28)31-21-9-12-24-36(31)38)35-23-11-10-22-34(35)33(19-3-1)32-25-13-16-27-14-5-7-17-29(27)32/h1-5,7-12,14,16-24,26,31,34-36H,6,13,15,25H2 |
| InChIKey | JRXKPWZRASMVPZ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |