C54H46 — CID 123809093
9-[6-(4a,8a-dihydronaphthalen-1-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]-10-[6-(2,3-dihydronaphthalen-1-yl)-7,8-dihydronaphthalen-2-yl]-4a,9a-dihydroanthracene (PubChem CID 123809093) has the molecular formula C54H46 and a molecular weight of 694.96 g/mol. Its IUPAC name is 9-[6-(4a,8a-dihydronaphthalen-1-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]-10-[6-(2,3-dihydronaphthalen-1-yl)-7,8-dihydronaphthalen-2-yl]-4a,9a-dihydroanthracene.
| Compound Name | 9-[6-(4a,8a-dihydronaphthalen-1-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]-10-[6-(2,3-dihydronaphthalen-1-yl)-7,8-dihydronaphthalen-2-yl]-4a,9a-dihydroanthracene |
|---|---|
| PubChem CID | 123809093 |
| Molecular Formula | C54H46 |
| Molecular Weight | 694.96 g/mol |
| Exact Mass | 694.36 |
| IUPAC Name | 9-[6-(4a,8a-dihydronaphthalen-1-yl)-3,4,7,8-tetrahydronaphthalen-2-yl]-10-[6-(2,3-dihydronaphthalen-1-yl)-7,8-dihydronaphthalen-2-yl]-4a,9a-dihydroanthracene |
| SMILES | C1=CC2C=CC=C(C3=CC4=C(C=C(C5=c6ccccc6=C(c6ccc7c(c6)CCC(C6=c8ccccc8=CCC6)=C7)C6C=CC=CC56)CC4)CC3)C2C=C1 |
| InChI | InChI=1S/C54H46/c1-3-15-45-35(11-1)13-9-21-47(45)41-27-23-39-33-43(29-25-37(39)31-41)53-49-17-5-7-19-51(49)54(52-20-8-6-18-50(52)53)44-30-26-38-32-42(28-24-40(38)34-44)48-22-10-14-36-12-2-4-16-46(36)48/h1-9,11-21,26,30-35,45,49,51H,10,22-25,27-29H2 |
| InChIKey | AGNYBLOCBPJMPM-UHFFFAOYSA-N |
| XLogP | 9.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.96 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |