C58H46 — CID 123255682
3-[10-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)-4a,8a-dihydronaphthalen-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-4a,9a-dihydroanthracen-9-yl]-1,2-dihydrofluoranthene (PubChem CID 123255682) has the molecular formula C58H46 and a molecular weight of 743.01 g/mol. Its IUPAC name is 3-[10-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)-4a,8a-dihydronaphthalen-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-4a,9a-dihydroanthracen-9-yl]-1,2-dihydrofluoranthene.
| Compound Name | 3-[10-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)-4a,8a-dihydronaphthalen-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-4a,9a-dihydroanthracen-9-yl]-1,2-dihydrofluoranthene |
|---|---|
| PubChem CID | 123255682 |
| Molecular Formula | C58H46 |
| Molecular Weight | 743.01 g/mol |
| Exact Mass | 742.36 |
| IUPAC Name | 3-[10-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)-4a,8a-dihydronaphthalen-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-4a,9a-dihydroanthracen-9-yl]-1,2-dihydrofluoranthene |
| SMILES | C1=CC2C=CC=C(C3=CC=C(C=CC4=CC=C(C5=c6ccccc6=C(C6=c7cccc8c7=C(CC6)c6ccccc6-8)C6C=CC=CC56)CC4)C4C=CC=CC34)C2C=C1 |
| InChI | InChI=1S/C58H46/c1-2-15-41-38(13-1)14-11-24-44(41)47-34-33-39(42-16-3-4-17-43(42)47)30-27-37-28-31-40(32-29-37)56-49-20-7-9-22-51(49)58(52-23-10-8-21-50(52)56)55-36-35-54-46-19-6-5-18-45(46)48-25-12-26-53(55)57(48)54/h1-28,30-31,33-34,38,41-43,49,51H,29,32,35-36H2 |
| InChIKey | DCCDZQYSGDRVGZ-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.01 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |