C52H44 — CID 123648265
9-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-10-(4b,8a-dihydrophenanthren-9-yl)-4a,9a-dihydroanthracene (PubChem CID 123648265) has the molecular formula C52H44 and a molecular weight of 668.92 g/mol. Its IUPAC name is 9-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-10-(4b,8a-dihydrophenanthren-9-yl)-4a,9a-dihydroanthracene.
| Compound Name | 9-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-10-(4b,8a-dihydrophenanthren-9-yl)-4a,9a-dihydroanthracene |
|---|---|
| PubChem CID | 123648265 |
| Molecular Formula | C52H44 |
| Molecular Weight | 668.92 g/mol |
| Exact Mass | 668.34 |
| IUPAC Name | 9-[4-[2-[4-(4a,8a-dihydronaphthalen-1-yl)cyclohexa-1,3-dien-1-yl]ethenyl]cyclohexa-1,3-dien-1-yl]-10-(4b,8a-dihydrophenanthren-9-yl)-4a,9a-dihydroanthracene |
| SMILES | C1=CC2C=CC=C(C3=CC=C(C=CC4=CC=C(C5=c6ccccc6=C(C6=Cc7ccccc7C7C=CC=CC67)C6C=CC=CC56)CC4)CC3)C2C=C1 |
| InChI | InChI=1S/C52H44/c1-3-15-41-37(12-1)14-11-23-42(41)38-30-26-35(27-31-38)24-25-36-28-32-39(33-29-36)51-46-19-7-9-21-48(46)52(49-22-10-8-20-47(49)51)50-34-40-13-2-4-16-43(40)44-17-5-6-18-45(44)50/h1-26,28,30,32,34,37,41,44-46,48H,27,29,31,33H2 |
| InChIKey | MOSYLPCYXFAHJO-UHFFFAOYSA-N |
| XLogP | 10.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.92 |
| LogP ≤ 5 | 10.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |