C42H36N2 — CID 174026097
3-[6-[(4S,10aS)-4,5-dimethyl-10-phenyl-3,4,5,10a-tetrahydroanthracen-9-yl]-7,8-dihydronaphthalen-2-yl]-5-pyridin-4-ylpyridine (PubChem CID 174026097) has the molecular formula C42H36N2 and a molecular weight of 568.76 g/mol. Its IUPAC name is 3-[6-[(4S,10aS)-4,5-dimethyl-10-phenyl-3,4,5,10a-tetrahydroanthracen-9-yl]-7,8-dihydronaphthalen-2-yl]-5-pyridin-4-ylpyridine.
| Compound Name | 3-[6-[(4S,10aS)-4,5-dimethyl-10-phenyl-3,4,5,10a-tetrahydroanthracen-9-yl]-7,8-dihydronaphthalen-2-yl]-5-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 174026097 |
| Molecular Formula | C42H36N2 |
| Molecular Weight | 568.76 g/mol |
| Exact Mass | 568.29 |
| IUPAC Name | 3-[6-[(4S,10aS)-4,5-dimethyl-10-phenyl-3,4,5,10a-tetrahydroanthracen-9-yl]-7,8-dihydronaphthalen-2-yl]-5-pyridin-4-ylpyridine |
| SMILES | CC1C=CC=C2C(C3=Cc4ccc(-c5cncc(-c6ccncc6)c5)cc4CC3)=C3C=CC[C@H](C)C3=C(c3ccccc3)[C@H]21 |
| InChI | InChI=1S/C42H36N2/c1-27-8-6-12-37-39(27)42(30-10-4-3-5-11-30)40-28(2)9-7-13-38(40)41(37)34-17-16-31-22-33(15-14-32(31)23-34)36-24-35(25-44-26-36)29-18-20-43-21-19-29/h3-8,10-15,18-28,39H,9,16-17H2,1-2H3/t27?,28-,39-/m0/s1 |
| InChIKey | OTVKVVLOGYXCON-LTMFRBLHSA-N |
| XLogP | 10.25 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.76 |
| LogP ≤ 5 | 10.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |