C51H37N3S — CID 145447985
2-[8-[6-(1,2,4b,8a-tetrahydrophenanthren-3-yl)-7,8-dihydronaphthalen-2-yl]dibenzothiophen-1-yl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 145447985) has the molecular formula C51H37N3S and a molecular weight of 723.95 g/mol. Its IUPAC name is 2-[8-[6-(1,2,4b,8a-tetrahydrophenanthren-3-yl)-7,8-dihydronaphthalen-2-yl]dibenzothiophen-1-yl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[8-[6-(1,2,4b,8a-tetrahydrophenanthren-3-yl)-7,8-dihydronaphthalen-2-yl]dibenzothiophen-1-yl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 145447985 |
| Molecular Formula | C51H37N3S |
| Molecular Weight | 723.95 g/mol |
| Exact Mass | 723.27 |
| IUPAC Name | 2-[8-[6-(1,2,4b,8a-tetrahydrophenanthren-3-yl)-7,8-dihydronaphthalen-2-yl]dibenzothiophen-1-yl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | C1=CC2C=CC3=C(C=C(C4=Cc5ccc(-c6ccc7sc8cccc(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)c8c7c6)cc5CC4)CC3)C2C=C1 |
| InChI | InChI=1S/C51H37N3S/c1-3-11-34(12-4-1)49-52-50(35-13-5-2-6-14-35)54-51(53-49)43-16-9-17-47-48(43)45-31-41(26-27-46(45)55-47)39-25-23-36-28-38(24-22-37(36)29-39)40-21-20-33-19-18-32-10-7-8-15-42(32)44(33)30-40/h1-19,23,25-32,42H,20-22,24H2 |
| InChIKey | MCTKBBGXFFYBMO-UHFFFAOYSA-N |
| XLogP | 13.18 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.95 |
| LogP ≤ 5 | 13.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |