C60H38N6S — CID 166565407
2-(4b,8a-dihydrotriphenylen-2-yl)-4-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 166565407) has the molecular formula C60H38N6S and a molecular weight of 875.07 g/mol. Its IUPAC name is 2-(4b,8a-dihydrotriphenylen-2-yl)-4-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(4b,8a-dihydrotriphenylen-2-yl)-4-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 166565407 |
| Molecular Formula | C60H38N6S |
| Molecular Weight | 875.07 g/mol |
| Exact Mass | 874.29 |
| IUPAC Name | 2-(4b,8a-dihydrotriphenylen-2-yl)-4-[3-[9-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-2-yl]phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | C1=CC2c3ccccc3-c3cc(-c4nc(-c5ccccc5)nc(-c5cccc(-c6ccc7sc8cccc(-c9nc(-c%10ccccc%10)nc(-c%10ccccc%10)n9)c8c7c6)c5)n4)ccc3C2C=C1 |
| InChI | InChI=1S/C60H38N6S/c1-4-16-37(17-5-1)55-62-58(64-59(63-55)43-30-32-48-46-26-11-10-24-44(46)45-25-12-13-27-47(45)50(48)36-43)42-23-14-22-40(34-42)41-31-33-52-51(35-41)54-49(28-15-29-53(54)67-52)60-65-56(38-18-6-2-7-19-38)61-57(66-60)39-20-8-3-9-21-39/h1-36,44,46H |
| InChIKey | DQTVOCQGEVSNAH-UHFFFAOYSA-N |
| XLogP | 15.07 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 875.07 |
| LogP ≤ 5 | 15.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |