C11H14O — CID 145444445
2,3-dihydronaphthalen-1-ol;methane (PubChem CID 145444445) has the molecular formula C11H14O and a molecular weight of 162.23 g/mol. Its IUPAC name is 2,3-dihydronaphthalen-1-ol;methane.
| Compound Name | 2,3-dihydronaphthalen-1-ol;methane |
|---|---|
| PubChem CID | 145444445 |
| Molecular Formula | C11H14O |
| Molecular Weight | 162.23 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 2,3-dihydronaphthalen-1-ol;methane |
| SMILES | C.OC1=c2ccccc2=CCC1 |
| InChI | InChI=1S/C10H10O.CH4/c11-10-7-3-5-8-4-1-2-6-9(8)10;/h1-2,4-6,11H,3,7H2;1H4 |
| InChIKey | DTNDCAUFYDIMMI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.23 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |