C14H12O2 — CID 141072383
2,3-dihydroanthracene-1,4-diol (PubChem CID 141072383) has the molecular formula C14H12O2 and a molecular weight of 212.25 g/mol. Its IUPAC name is 2,3-dihydroanthracene-1,4-diol.
| Compound Name | 2,3-dihydroanthracene-1,4-diol |
|---|---|
| PubChem CID | 141072383 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2,3-dihydroanthracene-1,4-diol |
| SMILES | OC1=c2cc3ccccc3cc2=C(O)CC1 |
| InChI | InChI=1S/C14H12O2/c15-13-5-6-14(16)12-8-10-4-2-1-3-9(10)7-11(12)13/h1-4,7-8,15-16H,5-6H2 |
| InChIKey | SOSLUKQJJBVOKZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |