About 1-methyl-2H-indene
1-methyl-2H-indene (PubChem CID 59944755) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is 1-methyl-2H-indene.
Molecular Properties
| Compound Name | 1-methyl-2H-indene |
| PubChem CID | 59944755 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | 1-methyl-2H-indene |
| SMILES | CC1=c2ccccc2=CC1 |
| InChI | InChI=1S/C10H10/c1-8-6-7-9-4-2-3-5-10(8)9/h2-5,7H,6H2,1H3 |
| InChIKey | RRIBAJVKLQMWGE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-methyl-2H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-indene?
The IUPAC name of 1-methyl-2H-indene (CID 59944755) is 1-methyl-2H-indene.
What is the SMILES notation for 1-methyl-2H-indene?
The canonical SMILES for 1-methyl-2H-indene is CC1=c2ccccc2=CC1.
What is the InChIKey of 1-methyl-2H-indene?
The InChIKey is RRIBAJVKLQMWGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-8-6-7-9-4-2-3-5-10(8)9/h2-5,7H,6H2,1H3.
What are the key properties of 1-methyl-2H-indene?
1-methyl-2H-indene has a molecular weight of 130.19 g/mol, XLogP of 1.04, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-indene is sourced from PubChem (CID 59944755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).