C12H16S — CID 143782367
methanethiol;1-methyl-2,3-dihydronaphthalene (PubChem CID 143782367) has the molecular formula C12H16S and a molecular weight of 192.33 g/mol. Its IUPAC name is methanethiol;1-methyl-2,3-dihydronaphthalene.
| Compound Name | methanethiol;1-methyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 143782367 |
| Molecular Formula | C12H16S |
| Molecular Weight | 192.33 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | methanethiol;1-methyl-2,3-dihydronaphthalene |
| SMILES | CC1=c2ccccc2=CCC1.CS |
| InChI | InChI=1S/C11H12.CH4S/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-2/h2-3,6-8H,4-5H2,1H3;2H,1H3 |
| InChIKey | PXQUXUONTXAFMV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|