C11H11F — CID 143753613
1-fluoro-4-methyl-2,3-dihydronaphthalene (PubChem CID 143753613) has the molecular formula C11H11F and a molecular weight of 162.21 g/mol. Its IUPAC name is 1-fluoro-4-methyl-2,3-dihydronaphthalene.
| Compound Name | 1-fluoro-4-methyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 143753613 |
| Molecular Formula | C11H11F |
| Molecular Weight | 162.21 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 1-fluoro-4-methyl-2,3-dihydronaphthalene |
| SMILES | CC1=c2ccccc2=C(F)CC1 |
| InChI | InChI=1S/C11H11F/c1-8-6-7-11(12)10-5-3-2-4-9(8)10/h2-5H,6-7H2,1H3 |
| InChIKey | GUZQAEMOSIIKJL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |