C10H13N — CID 145344243
4,7-dimethyl-5,6-dihydro-1H-indole (PubChem CID 145344243) has the molecular formula C10H13N and a molecular weight of 147.22 g/mol. Its IUPAC name is 4,7-dimethyl-5,6-dihydro-1H-indole.
| Compound Name | 4,7-dimethyl-5,6-dihydro-1H-indole |
|---|---|
| PubChem CID | 145344243 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.10 |
| IUPAC Name | 4,7-dimethyl-5,6-dihydro-1H-indole |
| SMILES | CC1=c2cc[nH]c2=C(C)CC1 |
| InChI | InChI=1S/C10H13N/c1-7-3-4-8(2)10-9(7)5-6-11-10/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | BDLZFPMYGMXEFL-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |