C12H15N — CID 123416584
4,9-dimethyl-7,8-dihydro-1H-cycloocta[b]pyrrole (PubChem CID 123416584) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 4,9-dimethyl-7,8-dihydro-1H-cycloocta[b]pyrrole.
| Compound Name | 4,9-dimethyl-7,8-dihydro-1H-cycloocta[b]pyrrole |
|---|---|
| PubChem CID | 123416584 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 4,9-dimethyl-7,8-dihydro-1H-cycloocta[b]pyrrole |
| SMILES | CC1=c2cc[nH]c2=C(C)CCC=C1 |
| InChI | InChI=1S/C12H15N/c1-9-5-3-4-6-10(2)12-11(9)7-8-13-12/h3,5,7-8,13H,4,6H2,1-2H3 |
| InChIKey | HRLDEXFBKVCMRC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |