C11H17N — CID 143140807
ethane;1,6,7,8-tetrahydrocyclohepta[b]pyrrole (PubChem CID 143140807) has the molecular formula C11H17N and a molecular weight of 163.26 g/mol. Its IUPAC name is ethane;1,6,7,8-tetrahydrocyclohepta[b]pyrrole.
| Compound Name | ethane;1,6,7,8-tetrahydrocyclohepta[b]pyrrole |
|---|---|
| PubChem CID | 143140807 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | ethane;1,6,7,8-tetrahydrocyclohepta[b]pyrrole |
| SMILES | C1=Cc2cc[nH]c2CCC1.CC |
| InChI | InChI=1S/C9H11N.C2H6/c1-2-4-8-6-7-10-9(8)5-3-1;1-2/h2,4,6-7,10H,1,3,5H2;1-2H3 |
| InChIKey | AECFOELQKWBRKK-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |