C8H10 — CID 123578884
bicyclo[5.1.0]octa-1(7),2-diene (PubChem CID 123578884) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is bicyclo[5.1.0]octa-1(7),2-diene.
| Compound Name | bicyclo[5.1.0]octa-1(7),2-diene |
|---|---|
| PubChem CID | 123578884 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | bicyclo[5.1.0]octa-1(7),2-diene |
| SMILES | C1=CC2=C(CCC1)C2 |
| InChI | InChI=1S/C8H10/c1-2-4-7-6-8(7)5-3-1/h2,4H,1,3,5-6H2 |
| InChIKey | CUDCEDZFTNTYRW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |