About 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine
6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine (PubChem CID 143582940) has the molecular formula C9H14N2
and a molecular weight of 150.22 g/mol. Its IUPAC name is 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine.
Analyze 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine?
The IUPAC name of 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine (CID 143582940) is 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine.
What is the SMILES notation for 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine?
The canonical SMILES for 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine is CN1CCc2cc[nH]c2CC1.
What is the InChIKey of 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine?
The InChIKey is CMFHDVULUQUOAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2/c1-11-6-3-8-2-5-10-9(8)4-7-11/h2,5,10H,3-4,6-7H2,1H3.
What are the key properties of 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine?
6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine has a molecular weight of 150.22 g/mol, XLogP of 1.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methyl-4,5,7,8-tetrahydro-1H-pyrrolo[2,3-d]azepine is sourced from PubChem (CID 143582940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).