C12H14BrN3 — CID 162388621
5-bromo-12-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene (PubChem CID 162388621) has the molecular formula C12H14BrN3 and a molecular weight of 280.17 g/mol. Its IUPAC name is 5-bromo-12-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene.
| Compound Name | 5-bromo-12-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene |
|---|---|
| PubChem CID | 162388621 |
| Molecular Formula | C12H14BrN3 |
| Molecular Weight | 280.17 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 5-bromo-12-methyl-6,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3,5-tetraene |
| SMILES | CN1CCc2[nH]c3nc(Br)ccc3c2CC1 |
| InChI | InChI=1S/C12H14BrN3/c1-16-6-4-8-9-2-3-11(13)15-12(9)14-10(8)5-7-16/h2-3H,4-7H2,1H3,(H,14,15) |
| InChIKey | IBTBJZRGSFWDQD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.17 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|