C13H17N3O — CID 167172411
5,12-dimethyl-5,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3-trien-6-one (PubChem CID 167172411) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 5,12-dimethyl-5,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3-trien-6-one.
| Compound Name | 5,12-dimethyl-5,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3-trien-6-one |
|---|---|
| PubChem CID | 167172411 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5,12-dimethyl-5,8,12-triazatricyclo[7.5.0.02,7]tetradeca-1(9),2(7),3-trien-6-one |
| SMILES | CN1CCc2[nH]c3c(=O)n(C)ccc3c2CC1 |
| InChI | InChI=1S/C13H17N3O/c1-15-6-3-9-10-4-8-16(2)13(17)12(10)14-11(9)5-7-15/h4,8,14H,3,5-7H2,1-2H3 |
| InChIKey | OZSGMUDUKRTESB-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |