C21H18BrN3O — CID 56763650
(6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1-methylindol-4-yl)methanone (PubChem CID 56763650) has the molecular formula C21H18BrN3O and a molecular weight of 408.30 g/mol. Its IUPAC name is (6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1-methylindol-4-yl)methanone.
| Compound Name | (6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1-methylindol-4-yl)methanone |
|---|---|
| PubChem CID | 56763650 |
| Molecular Formula | C21H18BrN3O |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.06 |
| IUPAC Name | (6-bromo-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(1-methylindol-4-yl)methanone |
| SMILES | Cn1ccc2c(C(=O)N3CCc4[nH]c5c(Br)cccc5c4C3)cccc21 |
| InChI | InChI=1S/C21H18BrN3O/c1-24-10-8-13-15(5-3-7-19(13)24)21(26)25-11-9-18-16(12-25)14-4-2-6-17(22)20(14)23-18/h2-8,10,23H,9,11-12H2,1H3 |
| InChIKey | BLWALLMIHMSNGU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|