C18H18BrN3OS — CID 75416966
6-bromo-N-(2-thiophen-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide (PubChem CID 75416966) has the molecular formula C18H18BrN3OS and a molecular weight of 404.33 g/mol. Its IUPAC name is 6-bromo-N-(2-thiophen-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide.
| Compound Name | 6-bromo-N-(2-thiophen-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
|---|---|
| PubChem CID | 75416966 |
| Molecular Formula | C18H18BrN3OS |
| Molecular Weight | 404.33 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 6-bromo-N-(2-thiophen-2-ylethyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-2-carboxamide |
| SMILES | O=C(NCCc1cccs1)N1CCc2[nH]c3c(Br)cccc3c2C1 |
| InChI | InChI=1S/C18H18BrN3OS/c19-15-5-1-4-13-14-11-22(9-7-16(14)21-17(13)15)18(23)20-8-6-12-3-2-10-24-12/h1-5,10,21H,6-9,11H2,(H,20,23) |
| InChIKey | HURPCTSDCJSQBS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.33 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|