C18H20N2O3 — CID 31894582
methyl 2-(3-methylbut-2-enoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate (PubChem CID 31894582) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is methyl 2-(3-methylbut-2-enoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate.
| Compound Name | methyl 2-(3-methylbut-2-enoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate |
|---|---|
| PubChem CID | 31894582 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | methyl 2-(3-methylbut-2-enoyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate |
| SMILES | COC(=O)c1cccc2c3c([nH]c12)CCN(C(=O)C=C(C)C)C3 |
| InChI | InChI=1S/C18H20N2O3/c1-11(2)9-16(21)20-8-7-15-14(10-20)12-5-4-6-13(17(12)19-15)18(22)23-3/h4-6,9,19H,7-8,10H2,1-3H3 |
| InChIKey | USFUWTDLDDWKKR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|