C18H20N2O5 — CID 75403121
methyl 2-(1,4-dioxane-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate (PubChem CID 75403121) has the molecular formula C18H20N2O5 and a molecular weight of 344.37 g/mol. Its IUPAC name is methyl 2-(1,4-dioxane-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate.
| Compound Name | methyl 2-(1,4-dioxane-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate |
|---|---|
| PubChem CID | 75403121 |
| Molecular Formula | C18H20N2O5 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | methyl 2-(1,4-dioxane-2-carbonyl)-1,3,4,5-tetrahydropyrido[4,3-b]indole-6-carboxylate |
| SMILES | COC(=O)c1cccc2c3c([nH]c12)CCN(C(=O)C1COCCO1)C3 |
| InChI | InChI=1S/C18H20N2O5/c1-23-18(22)12-4-2-3-11-13-9-20(6-5-14(13)19-16(11)12)17(21)15-10-24-7-8-25-15/h2-4,15,19H,5-10H2,1H3 |
| InChIKey | ROTAUSDTYAOAET-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 80.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|