C18H17N3O2 — CID 110667856
(6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-pyridin-2-ylmethanone (PubChem CID 110667856) has the molecular formula C18H17N3O2 and a molecular weight of 307.35 g/mol. Its IUPAC name is (6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-pyridin-2-ylmethanone.
| Compound Name | (6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 110667856 |
| Molecular Formula | C18H17N3O2 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | (6-methoxy-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-pyridin-2-ylmethanone |
| SMILES | COc1cccc2c3c([nH]c12)CCN(C(=O)c1ccccn1)C3 |
| InChI | InChI=1S/C18H17N3O2/c1-23-16-7-4-5-12-13-11-21(10-8-14(13)20-17(12)16)18(22)15-6-2-3-9-19-15/h2-7,9,20H,8,10-11H2,1H3 |
| InChIKey | CDJRYQKGCSBIBY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|