C18H16ClN3O2 — CID 70781886
(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methoxy-4-pyridinyl)methanone (PubChem CID 70781886) has the molecular formula C18H16ClN3O2 and a molecular weight of 341.80 g/mol. Its IUPAC name is (6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methoxy-4-pyridinyl)methanone.
| Compound Name | (6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methoxy-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 70781886 |
| Molecular Formula | C18H16ClN3O2 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | (6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-(2-methoxy-4-pyridinyl)methanone |
| SMILES | COc1cc(C(=O)N2CCc3[nH]c4c(Cl)cccc4c3C2)ccn1 |
| InChI | InChI=1S/C18H16ClN3O2/c1-24-16-9-11(5-7-20-16)18(23)22-8-6-15-13(10-22)12-3-2-4-14(19)17(12)21-15/h2-5,7,9,21H,6,8,10H2,1H3 |
| InChIKey | ZSSCIKGBGVYMJV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|