C16H18ClN3OS — CID 70775068
(6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[(4R)-3-methyl-1,3-thiazolidin-4-yl]methanone (PubChem CID 70775068) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is (6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[(4R)-3-methyl-1,3-thiazolidin-4-yl]methanone.
| Compound Name | (6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[(4R)-3-methyl-1,3-thiazolidin-4-yl]methanone |
|---|---|
| PubChem CID | 70775068 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (6-chloro-1,3,4,5-tetrahydropyrido[4,3-b]indol-2-yl)-[(4R)-3-methyl-1,3-thiazolidin-4-yl]methanone |
| SMILES | CN1CSC[C@H]1C(=O)N1CCc2[nH]c3c(Cl)cccc3c2C1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-19-9-22-8-14(19)16(21)20-6-5-13-11(7-20)10-3-2-4-12(17)15(10)18-13/h2-4,14,18H,5-9H2,1H3/t14-/m0/s1 |
| InChIKey | IISWKUJWEPUABA-AWEZNQCLSA-N |
| XLogP | 2.71 |
| TPSA | 39.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|